For research use only. Not for therapeutic Use.
ITI-722（Cat No.:I029652）is an investigational small molecule targeting the serotonin 5-HT2A receptor with high selectivity, being developed for the treatment of sleep disorders and psychosis associated with neurodegenerative diseases, such as Parkinson’s disease. Unlike traditional antipsychotics, ITI-722 exhibits a unique mechanism that modulates serotonin signaling without significant dopaminergic or histaminergic side effects. This profile makes it a promising candidate for improving sleep quality and treating psychotic symptoms in vulnerable populations, offering a safer therapeutic alternative with a lower risk of sedation, weight gain, or motor impairment.
| Catalog Number | I029652 |
| CAS Number | 313368-91-1 |
| Synonyms | ITI007; ITI-007; ITI007; ITI722; ITI 722; ITI-722 |
| Molecular Formula | C24H28FN3O |
| Purity | 98% |
| Target | Neuronal Signaling |
| Target Protein | P28223,P31645 |
| Solubility | Soluble in DMSO |
| Appearance | Solid |
| Storage | Dry, dark and at 2 - 8 °C for six months or -20°C for two years. |
| IC50 | D2 receptors (Ki = 32 nM) |
| IUPAC Name | 1-(4-fluorophenyl)-4-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butan-1-one |
| InChI | InChI=1S/C24H28FN3O/c1-26-14-15-28-21-11-13-27(16-20(21)19-4-2-5-22(26)24(19)28)12-3-6-23(29)17-7-9-18(25)10-8-17/h2,4-5,7-10,20-21H,3,6,11-16H2,1H3/t20-,21-/m0/s1 |
| InChIKey | HOIIHACBCFLJET-SFTDATJTSA-N |
| SMILES | CN1CCN2[C@H]3CCN(C[C@H]3C4=C2C1=CC=C4)CCCC(=O)C5=CC=C(C=C5)F |
| Reference | 1: Kumar B, Kuhad A, Kuhad A. Lumateperone: a new treatment approach for neuropsychiatric disorders. Drugs Today (Barc). 2018 Dec;54(12):713-719. doi: 10.1358/dot.2018.54.12.2899443. PubMed PMID: 30596390. |
