For research use only. Not for therapeutic Use.
ITI214 (Cat.No:I002147) is a novel small molecule drug being investigated for its potential therapeutic applications. It acts as a potent and selective inhibitor of phosphodiesterase 1 (PDE1), an enzyme involved in regulating intracellular levels of cyclic nucleotides. By inhibiting PDE1, ITI214 may modulate cellular signaling pathways and have potential therapeutic effects in various disease conditions. Clinical trials are being conducted to explore its efficacy and safety profile.
CAS Number | 1642303-38-5 |
Molecular Formula | C29H29FN7O5P |
Purity | ≥95% |
Target | Phosphodiesterase (PDE) |
Solubility | DMSO: ≥ 30 mg/mL |
Storage | Store at -20°C |
IC50 | 58 pM (Ki) |
InChI | InChI=1S/C29H26FN7O.H3O4P/c1-35-28(38)25-26(31-20-7-3-2-4-8-20)36(34-27(25)37-23-11-5-10-22(23)33-29(35)37)17-18-13-15-19(16-14-18)21-9-6-12-24(30)32-21;1-5(2,3)4/h2-4,6-9,12-16,22-23,31H,5,10-11,17H2,1H3;(H3,1,2,3,4)/t22-,23+;/m1./s1 |
InChIKey | ZPIAAFIYOPWWJL-RFPXDPOKSA-N |
SMILES | CN1C(=O)C2=C(N(N=C2N3C1=NC4C3CCC4)CC5=CC=C(C=C5)C6=NC(=CC=C6)F)NC7=CC=CC=C7.OP(=O)(O)O |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |