For research use only. Not for therapeutic Use.
ITK inhibitor 2 is a interleukin-2-inducible T-cell kinase (ITK) inhibitor extracted from patent WO2011065402A1, compound 4, with an IC50 of 2 nM.
| Catalog Number | I018638 |
| CAS Number | 1309784-09-5 |
| Synonyms | (2S)-N-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indol-6-yl]-N-methyl-2-morpholin-4-ylpropanamide |
| Molecular Formula | C25H33N5O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C25H33N5O2/c1-16(30-9-11-32-12-10-30)24(31)29(4)18-6-5-17-13-21(26-20(17)14-18)23-19-7-8-25(2,3)15-22(19)27-28-23/h5-6,13-14,16,26H,7-12,15H2,1-4H3,(H,27,28)/t16-/m0/s1 |
| InChIKey | ZZZXGCPVQQOASC-INIZCTEOSA-N |
| SMILES | CC(C(=O)N(C)C1=CC2=C(C=C1)C=C(N2)C3=NNC4=C3CCC(C4)(C)C)N5CCOCC5 |
| Reference | [1]. Teruhiko Inoue, et al. Indole compounds and their pharmaceutical use. |
