For research use only. Not for therapeutic Use.
Itopride-d6 Hydrochloride is an isotopically labeled version of Itopride hydrochloride, a gastroprokinetic agent that enhances gastrointestinal motility. Enhanced with six deuterium atoms, this compound is particularly valuable for pharmacokinetic and metabolic studies in drug development. The deuterium labeling ensures reduced metabolic degradation, allowing for more precise and reliable measurement in analytical methods such as mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. Itopride-d6 Hydrochloride is crucial for researchers investigating the drug’s absorption, distribution, metabolism, and excretion (ADME) profiles, offering insights that are essential for optimizing dosage and improving therapeutic efficacy.
CAS Number | 1346601-02-2 |
Synonyms | N-[[4-[2-(Dimethylamino-d6)ethoxy]phenyl]methyl]-3,4-dimethoxy Benzamide Hydrochloride; HSR-803-d6; HC-803-d6; Itax-d6; Ganaton-d6; |
Molecular Formula | C20H27ClN2O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-[[4-[2-[bis(trideuteriomethyl)amino]ethoxy]phenyl]methyl]-3,4-dimethoxybenzamide;hydrochloride |
InChI | InChI=1S/C20H26N2O4.ClH/c1-22(2)11-12-26-17-8-5-15(6-9-17)14-21-20(23)16-7-10-18(24-3)19(13-16)25-4;/h5-10,13H,11-12,14H2,1-4H3,(H,21,23);1H/i1D3,2D3; |
InChIKey | ZTOUXLLIPWWHSR-TXHXQZCNSA-N |
SMILES | [2H]C([2H])([2H])N(CCOC1=CC=C(C=C1)CNC(=O)C2=CC(=C(C=C2)OC)OC)C([2H])([2H])[2H].Cl |