For research use only. Not for therapeutic Use.
ITSA-1(Cat No.:I002540)is a selective inhibitor of the protein kinase casein kinase 2 (CK2), which is involved in regulating various cellular processes, including cell proliferation, differentiation, and apoptosis. By inhibiting CK2 activity, ITSA-1 disrupts signaling pathways associated with cancer development and progression. Preclinical studies have shown that ITSA-1 can induce apoptosis in cancer cells and enhance the effectiveness of other therapies, making it a promising candidate for cancer treatment. Its specificity and potency position ITSA-1 as a valuable tool for investigating CK2’s role in tumor biology and therapeutic resistance.
CAS Number | 200626-61-5 |
Synonyms | (1H-benzo[d][1,2,3]triazol-1-yl)(2,4-dichlorophenyl)methanone |
Molecular Formula | C₁₃H₇Cl₂N₃O |
Purity | ≥95% |
Target | Epigenetics |
Solubility | DMSO ≥ 32 mg/mL |
Storage | Store at -20°C |
IUPAC Name | benzotriazol-1-yl-(2,4-dichlorophenyl)methanone |
InChI | InChI=1S/C13H7Cl2N3O/c14-8-5-6-9(10(15)7-8)13(19)18-12-4-2-1-3-11(12)16-17-18/h1-7H |
InChIKey | UVNLAUGZMOPBPR-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)N=NN2C(=O)C3=C(C=C(C=C3)Cl)Cl |
Reference | <p style=/line-height:25px/> </p> |