For research use only. Not for therapeutic Use.
Ivabradine Impurity (Cat.No:M020864) is a chemical compound identified as a byproduct or variant during the synthesis of Ivabradine, a medication used to treat certain heart conditions. Impurities like this are closely monitored during drug manufacturing to ensure the quality, safety, and efficacy of the final pharmaceutical product.
CAS Number | 1616710-50-9 |
Synonyms | Ivabradine IMpurity;3-O-Desmethyl Ivabradine;Ivabradine Impurity 10;Ivabradine Impurity 12;Ivabradine Impurity 2;Ivabradine Impurity 3;Ivabradine Impurity 4;Ivabradine Impurity 6 |
Molecular Formula | C27H35ClN2O6 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 3-[3-[[(7S)-3,4-dimethoxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]methyl-methylamino]propyl]-7,8-dimethoxy-1,2-dihydro-3-benzazepine-4,5-dione;hydrochloride |
InChI | InChI=1S/C27H34N2O6.ClH/c1-28(16-19-11-18-13-23(33-3)24(34-4)14-20(18)19)8-6-9-29-10-7-17-12-22(32-2)25(35-5)15-21(17)26(30)27(29)31;/h12-15,19H,6-11,16H2,1-5H3;1H/t19-;/m1./s1 |
InChIKey | GSZCZNYQYXAECA-FSRHSHDFSA-N |
SMILES | CN(CCCN1CCC2=CC(=C(C=C2C(=O)C1=O)OC)OC)CC3CC4=CC(=C(C=C34)OC)OC.Cl |