For research use only. Not for therapeutic Use.
Ivermectin（Cat No.:A000480）is a broad-spectrum antiparasitic medication used to treat various parasitic infections, including onchocerciasis (river blindness), strongyloidiasis, and scabies. It works by binding to glutamate-gated chloride channels in the nerve and muscle cells of parasites, causing paralysis and death. Ivermectin is effective against a range of parasites, including nematodes and arthropods. It has gained attention for its potential use in treating and preventing COVID-19, though more research is needed to confirm efficacy. Generally well-tolerated, Ivermectin is a vital tool in global efforts to control parasitic diseases.
| Catalog Number | A000480 |
| CAS Number | 70288-86-7 |
| Synonyms | MK933; Ivermectin B1a; IVERMECTIN; 22,23-Dihydroavermectin B1a; Dihydroavermectin B1a; Avermectin H2B1a; 70288-86-7 |
| Molecular Formula | C48H74O14 |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | >43.8mg/mL in DMSO |
| Storage | -20°C |
| IUPAC Name | (1R,4S,5'S,6R,6'R,8R,10E,12S,13S,14E,16E,20R,21R,24S)-6'-[(2S)-butan-2-yl]-21,24-dihydroxy-12-[(2R,4S,5S,6S)-5-[(2S,4S,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-5',11,13,22-tetramethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one |
| InChI | InChI=1S/C48H74O14/c1-11-25(2)43-28(5)17-18-47(62-43)23-34-20-33(61-47)16-15-27(4)42(26(3)13-12-14-32-24-55-45-40(49)29(6)19-35(46(51)58-34)48(32,45)52)59-39-22-37(54-10)44(31(8)57-39)60-38-21-36(53-9)41(50)30(7)56-38/h12-15,19,25-26,28,30-31,33-45,49-50,52H,11,16-18,20-24H2,1-10H3/b13-12+,27-15+,32-14+/t25-,26-,28-,30-,31-,33+,34-,35-,36-,37-,38-,39-,40+,41-,42-,43+,44-,45+,47+,48+/m0/s1 |
| InChIKey | AZSNMRSAGSSBNP-XPNPUAGNSA-N |
| SMILES | CCC(C)C1C(CCC2(O1)CC3CC(O2)CC=C(C(C(C=CC=C4COC5C4(C(C=C(C5O)C)C(=O)O3)O)C)OC6CC(C(C(O6)C)OC7CC(C(C(O7)C)O)OC)OC)C)C |
