For research use only. Not for therapeutic Use.
IWP-2 (CAT: I004582) is a small molecule inhibitor that specifically targets the Wnt signaling pathway. It functions by inhibiting the enzyme Porcupine, which is responsible for the lipid modification of Wnt proteins. By blocking Wnt secretion and preventing its binding to cell surface receptors, IWP-2 effectively disrupts Wnt signaling. This pathway plays a crucial role in embryonic development, tissue homeostasis, and stem cell maintenance. IWP-2 has been widely used in research to study the role of Wnt signaling in various biological processes, including embryogenesis, tissue regeneration, and cancer. Its selective inhibition of Porcupine makes it a valuable tool for investigating Wnt-related diseases and potential therapeutic targets.
CAS Number | 686770-61-6 |
Synonyms | IWP-2; N-(6-methyl-1,3-benzothiazol-2-yl)-2-[(4-oxo-3-phenyl-6,7-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]acetamide |
Molecular Formula | C₂₂H₁₈N₄O₃S₃ |
Purity | ≥95% |
Target | Wnt |
Solubility | DMSO: < 4.7 mg/mL |
Storage | -20 ℃ |
IC50 | 27 nM |
IUPAC Name | N-(6-methyl-1,3-benzothiazol-2-yl)-2-[(4-oxo-3-phenyl-6,7-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]acetamide |
InChI | InChI=1S/C22H18N4O2S3/c1-13-7-8-15-17(11-13)31-21(23-15)25-18(27)12-30-22-24-16-9-10-29-19(16)20(28)26(22)14-5-3-2-4-6-14/h2-8,11H,9-10,12H2,1H3,(H,23,25,27) |
InChIKey | WRKPZSMRWPJJDH-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C=C1)N=C(S2)NC(=O)CSC3=NC4=C(C(=O)N3C5=CC=CC=C5)SCC4 |