For research use only. Not for therapeutic Use.
Izaflortaucipir-F19(CAT: I029692)is a non-radio-labeled version of Izaflortaucipir. Izaflortaucipir itself is a radio diagnostic agent that is labeled with F18, a radioactive isotope of fluorine. Radiodiagnostic agents like Izaflortaucipir are used in medical imaging, specifically in positron emission tomography (PET) scans, to detect and visualize specific molecular targets in the body. While Izaflortaucipir-F19 lacks the radioisotope, it can be utilized for non-radioactive studies and investigations, potentially aiding in the research and development of diagnostic approaches.
| Catalog Number | I029692 |
| CAS Number | 2173361-80-1 |
| Synonyms | Izaflortaucipir-F19; Izaflortaucipir; |
| Molecular Formula | C15H9FN4 |
| Purity | 98% |
| Target | Cytoskeleton |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 2-(2-fluoropyridin-4-yl)-9H-pyrrolo[2,3-b:4,5-c']dipyridine |
| InChI | InChI=1S/C15H9FN4/c16-14-7-9(3-6-18-14)12-2-1-10-11-8-17-5-4-13(11)20-15(10)19-12/h1-8H,(H,19,20) |
| InChIKey | JUPWIBZGGFVBCU-UHFFFAOYSA-N |
| SMILES | FC1=NC=CC(C2=NC(NC3=C4C=NC=C3)=C4C=C2)=C1 |
