For research use only. Not for therapeutic Use.
JA2131(Cat No.:I042324)is a small molecule compound under investigation for its potential therapeutic applications, particularly in oncology and other disease areas involving abnormal cell proliferation. It works by targeting specific proteins or enzymes involved in cellular processes like growth, survival, or apoptosis. JA2131 has shown promise in preclinical studies for inhibiting cancer cell proliferation and potentially overcoming resistance to other treatments. Researchers are also exploring its effects in combination with other therapies to enhance efficacy.
CAS Number | 6505-99-3 |
Synonyms | 1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-6-sulfanylidene-7H-purin-2-one |
Molecular Formula | C13H19N5O2S2 |
Purity | ≥95% |
IUPAC Name | 1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-6-sulfanylidene-7H-purin-2-one |
InChI | InChI=1S/C13H19N5O2S2/c1-16-10-9(11(21)17(2)13(16)19)14-12(15-10)22-8-5-18-3-6-20-7-4-18/h3-8H2,1-2H3,(H,14,15) |
InChIKey | XHNSOGDMSSHQFY-UHFFFAOYSA-N |
SMILES | CN1C2=C(C(=S)N(C1=O)C)NC(=N2)SCCN3CCOCC3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |