For research use only. Not for therapeutic Use.
JAK-IN-21（Cat No.:I042904）is a selective small molecule inhibitor that targets Janus kinases (JAKs), enzymes involved in the JAK-STAT signaling pathway. This pathway plays a crucial role in regulating immune responses, cell growth, and inflammation. By inhibiting JAKs, JAK-IN-21 aims to modulate the immune system and reduce the production of pro-inflammatory cytokines, making it a potential therapeutic for autoimmune diseases, inflammatory conditions, and certain cancers. Ongoing research is focused on evaluating the safety, efficacy, and clinical potential of JAK-IN-21, particularly in treating conditions like rheumatoid arthritis and psoriasis.
| CAS Number | 2445499-20-5 |
| Synonyms | N-(cyanomethyl)-4-[2-[[1-(cyanomethyl)pyrazol-4-yl]amino]-5-methylpyrimidin-4-yl]benzamide |
| Molecular Formula | C19H16N8O |
| Purity | ≥95% |
| IUPAC Name | N-(cyanomethyl)-4-[2-[[1-(cyanomethyl)pyrazol-4-yl]amino]-5-methylpyrimidin-4-yl]benzamide |
| InChI | InChI=1S/C19H16N8O/c1-13-10-23-19(25-16-11-24-27(12-16)9-7-21)26-17(13)14-2-4-15(5-3-14)18(28)22-8-6-20/h2-5,10-12H,8-9H2,1H3,(H,22,28)(H,23,25,26) |
| InChIKey | HTJNRNRPDXBRQY-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(N=C1C2=CC=C(C=C2)C(=O)NCC#N)NC3=CN(N=C3)CC#N |
