For research use only. Not for therapeutic Use.
JAK-IN-23(Cat No.:I042829)is a small molecule inhibitor that targets Janus kinases (JAKs), specifically designed to modulate the JAK-STAT signaling pathway. JAKs are critical enzymes involved in immune cell signaling and are implicated in various autoimmune diseases, inflammatory conditions, and cancers. By inhibiting JAKs, JAK-IN-23 aims to reduce the production of pro-inflammatory cytokines and modulate immune responses. It has shown potential in the treatment of diseases like rheumatoid arthritis, psoriasis, and certain types of cancer. Ongoing research is focused on evaluating its safety, efficacy, and clinical applications in immune-mediated disorders and malignancies.
CAS Number | 3031837-35-8 |
Synonyms | 2,6-dichloro-4-[2-methyl-1-(1-methylpiperidin-4-yl)imidazo[4,5-c]quinolin-8-yl]phenol |
Molecular Formula | C23H22Cl2N4O |
Purity | ≥95% |
IUPAC Name | 2,6-dichloro-4-[2-methyl-1-(1-methylpiperidin-4-yl)imidazo[4,5-c]quinolin-8-yl]phenol |
InChI | InChI=1S/C23H22Cl2N4O/c1-13-27-21-12-26-20-4-3-14(15-10-18(24)23(30)19(25)11-15)9-17(20)22(21)29(13)16-5-7-28(2)8-6-16/h3-4,9-12,16,30H,5-8H2,1-2H3 |
InChIKey | JEESDVDVWGRNFE-UHFFFAOYSA-N |
SMILES | CC1=NC2=CN=C3C=CC(=CC3=C2N1C4CCN(CC4)C)C5=CC(=C(C(=C5)Cl)O)Cl |