For research use only. Not for therapeutic Use.
Potent and selective Janus Kinase 2 (JAK2) inhibitor; inhibits the activity of both the wild-type JAK2 and the V617F mutant (IC50 = 78 and 206 nM, respectively), with >35-fold selectivity versus JAK3 (IC50 = 2.93 µM)
| Catalog Number | I047567 |
| CAS Number | 1110502-30-1 |
| Molecular Formula | C17H20N4O2S |
| Purity | ≥95% |
| IUPAC Name | 4-(3-amino-1H-indazol-5-yl)-N-tert-butylbenzenesulfonamide |
| InChI | InChI=1S/C17H20N4O2S/c1-17(2,3)21-24(22,23)13-7-4-11(5-8-13)12-6-9-15-14(10-12)16(18)20-19-15/h4-10,21H,1-3H3,(H3,18,19,20) |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC=C(C=C1)C2=CC3=C(C=C2)NN=C3N |
| Reference | S Antonysamy et al. Fragment-based discovery of JAK-2 inhibitors. Bioorg. Med. Chem. Lett. 2009, 19(1), 279-282. |
