For research use only. Not for therapeutic Use.
JAK2 JH2 binder-1（Cat No.:I043562）is a small molecule inhibitor designed to specifically target and bind to the JH2 (Janus homology 2) domain of the JAK2 (Janus kinase 2) enzyme. JAK2 plays a critical role in cytokine signaling and the regulation of hematopoiesis, and its dysregulation is associated with various hematologic diseases, including myeloproliferative disorders. By inhibiting the JH2 domain, JAK2 JH2 binder-1 aims to reduce the overactivation of JAK2, potentially offering therapeutic benefits in diseases such as polycythemia vera, essential thrombocythemia, and myelofibrosis. It is under investigation for its efficacy in clinical settings.
| CAS Number | 2923309-41-3 |
| Synonyms | 5-[4-[[5-amino-3-(4-sulfamoylanilino)-1,2,4-triazole-1-carbonyl]amino]phenyl]-2-phenylmethoxybenzoic acid |
| Molecular Formula | C29H25N7O6S |
| Purity | ≥95% |
| IUPAC Name | 5-[4-[[5-amino-3-(4-sulfamoylanilino)-1,2,4-triazole-1-carbonyl]amino]phenyl]-2-phenylmethoxybenzoic acid |
| InChI | InChI=1S/C29H25N7O6S/c30-27-34-28(32-21-11-13-23(14-12-21)43(31,40)41)35-36(27)29(39)33-22-9-6-19(7-10-22)20-8-15-25(24(16-20)26(37)38)42-17-18-4-2-1-3-5-18/h1-16H,17H2,(H,33,39)(H,37,38)(H2,31,40,41)(H3,30,32,34,35) |
| InChIKey | KMNBCUUTUMNJGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C3=CC=C(C=C3)NC(=O)N4C(=NC(=N4)NC5=CC=C(C=C5)S(=O)(=O)N)N)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
