For research use only. Not for therapeutic Use.
JAK3 Inhibitor VI（Cat No.:I029719）is a selective small molecule inhibitor of Janus kinase 3 (JAK3), a member of the JAK family of protein kinases involved in cytokine signaling. JAK3 plays a crucial role in the immune system, particularly in lymphocyte development and function. Inhibiting JAK3 can suppress inflammatory responses and immune cell activation, making it a potential therapeutic strategy for autoimmune diseases and inflammatory conditions such as rheumatoid arthritis, psoriasis, and graft-versus-host disease. JAK3 Inhibitor VI is being studied in preclinical research for its ability to modulate immune responses and reduce disease activity.
| Catalog Number | I029719 |
| CAS Number | 856436-16-3 |
| Synonyms | JAK3 Inhibitor VI; JAK-3 Inhibitor VI; JAK 3 Inhibitor VI |
| Molecular Formula | C19H17N3O4S |
| Purity | 98% |
| Target | Stem Cell/Wnt |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | methanesulfonic acid;(3Z)-5-pyridin-3-yl-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one |
| InChI | InChI=1S/C18H13N3O.CH4O3S/c22-18-16(10-14-4-2-8-20-14)15-9-12(5-6-17(15)21-18)13-3-1-7-19-11-13;1-5(2,3)4/h1-11,20H,(H,21,22);1H3,(H,2,3,4)/b16-10-; |
| InChIKey | ZUDPNBZMAJGYTE-HYMQDMCPSA-N |
| SMILES | CS(=O)(=O)O.C1=CC(=CN=C1)C2=CC\3=C(C=C2)NC(=O)/C3=C\C4=CC=CN4 |
| Reference | 1: Nishiya N, Sakamoto Y, Oku Y, Nonaka T, Uehara Y. JAK3 inhibitor VI is a mutant specific inhibitor for epidermal growth factor receptor with the gatekeeper mutation T790M. World J Biol Chem. 2015 Nov 26;6(4):409-18. doi: 10.4331/wjbc.v6.i4.409. PubMed PMID: 26629323; PubMed Central PMCID: PMC4657120. |
