For research use only. Not for therapeutic Use.
Jasmone (Cat No.:I014417) is an organic compound known for its jasmine-like fragrance. It is a clear to pale yellow liquid with a floral scent, resembling the aroma of jasmine flowers. Derived from various plants, including jasmine, jasmone is widely used in perfumery and cosmetics due to its pleasant fragrance. Additionally, it has garnered attention for its potential biological activities, such as antioxidant and antimicrobial properties, making it a subject of interest in natural product research. Jasmone offers a versatile aromatic compound that contributes to the sensory experience in fragrances and personal care products.
| Catalog Number | I014417 |
| CAS Number | 488-10-8 |
| Synonyms | Jasmone; (Z)-Jasmone; BRN 1907713; BRN-1907713; BRN1907713; FEMA No. 3196; HSDB 8273;;(E)-3-methyl-2-(pent-2-en-1-yl)cyclopent-2-en-1-one |
| Molecular Formula | C11H16O |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Solubility | Soluble in DMSO |
| Storage | Room Temperature |
| IUPAC Name | 3-methyl-2-[(Z)-pent-2-enyl]cyclopent-2-en-1-one |
| InChI | InChI=1S/C11H16O/c1-3-4-5-6-10-9(2)7-8-11(10)12/h4-5H,3,6-8H2,1-2H3/b5-4- |
| InChIKey | XMLSXPIVAXONDL-PLNGDYQASA-N |
| SMILES | CCC=CCC1=C(CCC1=O)C |
