For research use only. Not for therapeutic Use.
Jatrorrhizine Chloride (Cat.No:R025195) is a natural alkaloid compound extracted from the roots of plants like Coptis chinensis. It exhibits various pharmacological activities, including antimicrobial, anti-inflammatory, and antitumor effects. Jatrorrhizine Chloride’s versatile properties make it a subject of interest in traditional medicine research and potential modern therapeutic applications.
Catalog Number | R025195 |
CAS Number | 6681-15-8 |
Synonyms | 7,8,13,13a-Tetradehydro-3-hydroxy-2,9,10-trimethoxyberbinium Chloride; 5,6-Dihydro-3-hydroxy-2,9,10-trimethoxydibenzo[a,g]quinolizinium Chloride ?Jatrorrhizine Chloride; NSC 645313; Neprotine chloride |
Molecular Formula | C₂₀H₂₀ClNO₄ |
Purity | ≥95% |
Target | GPCR/G Protein |
Storage | Store at -20°C |
IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol;chloride |
InChI | InChI=1S/C20H19NO4.ClH/c1-23-18-5-4-12-8-16-14-10-19(24-2)17(22)9-13(14)6-7-21(16)11-15(12)20(18)25-3;/h4-5,8-11H,6-7H2,1-3H3;1H |
InChIKey | JKMUUZMCSNHBAX-UHFFFAOYSA-N |
SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC.[Cl-] |