For research use only. Not for therapeutic Use.
JBSNF-000028 hydrochloride（Cat No.:I041220）is a chemical compound used in pharmaceutical and biochemical research. It is a selective inhibitor or modulator targeting specific molecular pathways, often involved in disease processes such as cancer, inflammation, or metabolic disorders. As a hydrochloride salt, it enhances the stability, solubility, and bioavailability of the compound, making it suitable for in vitro and in vivo studies. Researchers use JBSNF-000028 hydrochloride to explore its potential as a therapeutic agent, evaluating its effects on target proteins or enzymes to better understand disease mechanisms and therapeutic interventions.
| Synonyms | 10-methyl-1,10-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-11-imine;hydrochloride |
| Molecular Formula | C11H14ClN3 |
| Purity | ≥95% |
| IUPAC Name | 10-methyl-1,10-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-11-imine;hydrochloride |
| InChI | InChI=1S/C11H13N3.ClH/c1-13-7-9-4-2-3-8-5-6-14(10(8)9)11(13)12;/h2-4,12H,5-7H2,1H3;1H |
| InChIKey | LFWOBKBWQJXSHT-UHFFFAOYSA-N |
| SMILES | CN1CC2=CC=CC3=C2N(C1=N)CC3.Cl |
