For research use only. Not for therapeutic Use.
JBSNF-000028 TFA（Cat No.:I041221）is a chemical compound used primarily in pharmaceutical and biochemical research. As a selective inhibitor or modulator, it is designed to target specific molecular pathways involved in disease progression, such as cancer, inflammation, or metabolic disorders. The trifluoroacetate (TFA) salt form enhances the solubility, stability, and bioavailability of the compound, making it suitable for in vitro and in vivo studies. Researchers investigate its potential as a therapeutic agent, exploring its effects on target proteins or enzymes to gain insights into disease mechanisms and to develop novel treatments.
| Synonyms | 10-methyl-1,10-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-11-imine;2,2,2-trifluoroacetic acid |
| Molecular Formula | C13H14F3N3O2 |
| Purity | ≥95% |
| IUPAC Name | 10-methyl-1,10-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-11-imine;2,2,2-trifluoroacetic acid |
| InChI | InChI=1S/C11H13N3.C2HF3O2/c1-13-7-9-4-2-3-8-5-6-14(10(8)9)11(13)12;3-2(4,5)1(6)7/h2-4,12H,5-7H2,1H3;(H,6,7) |
| InChIKey | WLCIAJGSNKEYTP-UHFFFAOYSA-N |
| SMILES | CN1CC2=CC=CC3=C2N(C1=N)CC3.C(=O)(C(F)(F)F)O |
