For research use only. Not for therapeutic Use.
JFD00244（Cat No.:I011797）is a small molecule compound that acts as a selective inhibitor of the protein kinase CLK2 (CDC2-like kinase 2). By targeting CLK2, JFD00244 disrupts the phosphorylation of serine/arginine-rich splicing factors, thereby influencing alternative splicing and impacting various cellular processes, including proliferation and survival. This compound has gained attention in cancer research for its potential to alter splicing patterns in tumor cells, which may enhance sensitivity to treatment and inhibit tumor growth. JFD00244 serves as a valuable tool for studying splicing regulation and developing novel cancer therapeutics targeting CLK2-related pathways.
| Catalog Number | I011797 |
| CAS Number | 96969-83-4 |
| Synonyms | 1,4-<em>bis</em>[[2-(4-hydroxyphenyl)ethyl]amino]-9,10-anthracenedione |
| Molecular Formula | C30H26N2O4 |
| Purity | ≥95% |
| Target | Sirtuin |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 1,4-bis[2-(4-hydroxyphenyl)ethylamino]anthracene-9,10-dione |
| InChI | InChI=1S/C30H26N2O4/c33-21-9-5-19(6-10-21)15-17-31-25-13-14-26(32-18-16-20-7-11-22(34)12-8-20)28-27(25)29(35)23-3-1-2-4-24(23)30(28)36/h1-14,31-34H,15-18H2 |
| InChIKey | UUJHFIBEJJLZBF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C=CC(=C3C2=O)NCCC4=CC=C(C=C4)O)NCCC5=CC=C(C=C5)O |
