For research use only. Not for therapeutic Use.
JHDM-IN-1(Cat No.:I041140)is a selective inhibitor targeting Jumonji C domain-containing protein 2A (JHDM2A), an enzyme involved in the demethylation of histone H3 at lysine 9 (H3K9). By inhibiting JHDM2A, JHDM-IN-1 disrupts the regulation of gene expression associated with various diseases, including cancer and neurological disorders. This compound offers potential for therapeutic interventions by modulating epigenetic modifications, specifically in diseases linked to aberrant histone modifications. Its specificity and efficacy in preclinical studies suggest promise for further development in targeted cancer therapies and other epigenetic-related diseases.
CAS Number | 1310809-17-6 |
Synonyms | (E)-4-[hydroxy-[4-[[4-(naphthalen-1-ylcarbamoyloxymethyl)phenyl]methylamino]butyl]amino]-4-oxobut-2-enoic acid |
Molecular Formula | C27H29N3O6 |
Purity | ≥95% |
IUPAC Name | (E)-4-[hydroxy-[4-[[4-(naphthalen-1-ylcarbamoyloxymethyl)phenyl]methylamino]butyl]amino]-4-oxobut-2-enoic acid |
InChI | InChI=1S/C27H29N3O6/c31-25(14-15-26(32)33)30(35)17-4-3-16-28-18-20-10-12-21(13-11-20)19-36-27(34)29-24-9-5-7-22-6-1-2-8-23(22)24/h1-2,5-15,28,35H,3-4,16-19H2,(H,29,34)(H,32,33)/b15-14+ |
InChIKey | FOJNYQXAAPCEPX-CCEZHUSRSA-N |
SMILES | C1=CC=C2C(=C1)C=CC=C2NC(=O)OCC3=CC=C(C=C3)CNCCCCN(C(=O)/C=C/C(=O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |