For research use only. Not for therapeutic Use.
Jineol is a cytotoxic alkaloid from the centipede Scolopendra subspinipes. Jineol exhibits modest cytotoxic activity in vitro against the growth of human tumor cell lines[1].
| Catalog Number | I029789 |
| CAS Number | 178762-28-2 |
| Synonyms | quinoline-3,8-diol |
| Molecular Formula | C9H7NO2 |
| Purity | ≥95% |
| InChI | InChI=1S/C9H7NO2/c11-7-4-6-2-1-3-8(12)9(6)10-5-7/h1-5,11-12H |
| InChIKey | IGDFDIZIHMFYGR-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)O)O |
| Reference | [1]. Surk-Sik Moon, et al. Jineol, a Cytotoxic Alkaloid from the Centipede Scolopendra subspinipes. |
