For research use only. Not for therapeutic Use.
Jineol（Cat No.:I029789）is a bioactive compound derived from natural sources, known for its anti-inflammatory and antioxidant properties. It is often studied for its potential therapeutic applications in managing conditions such as inflammation, oxidative stress, and immune-related disorders. Jineol has been shown to modulate key signaling pathways involved in immune cell activation and cytokine production, which may help in reducing inflammation and promoting overall health. Due to its beneficial effects on cellular processes, Jineol is being explored in the context of various disease models, particularly those related to chronic inflammation and autoimmune diseases.
| CAS Number | 178762-28-2 |
| Synonyms | quinoline-3,8-diol |
| Molecular Formula | C9H7NO2 |
| Purity | ≥95% |
| IUPAC Name | quinoline-3,8-diol |
| InChI | InChI=1S/C9H7NO2/c11-7-4-6-2-1-3-8(12)9(6)10-5-7/h1-5,11-12H |
| InChIKey | IGDFDIZIHMFYGR-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
