For research use only. Not for therapeutic Use.
JJKK048 (CAT: I007414) is an ultrapotent and highly selective inhibitor of monoacylglycerol lipase (MAGL). MAGL is an enzyme responsible for the hydrolysis of the endocannabinoid 2-arachidonoylglycerol (2-AG), which plays a role in the endocannabinoid signaling system. By inhibiting MAGL, JJKK048 may modulate the levels of 2-AG, leading to potential effects on various physiological processes, including pain, inflammation, and neurological functions.
| Catalog Number | I007414 |
| CAS Number | 1515855-97-6 |
| Synonyms | JJKK048; JJKK-048; JJKK 048.;(4-(bis(benzo[d][1,3]dioxol-5-yl)methyl)piperidin-1-yl)(1H-1,2,4-triazol-1-yl)methanone |
| Molecular Formula | C23H22N4O5 |
| Purity | ≥95% |
| Target | MAGL |
| Solubility | Soluble in DMSO, not in water |
| Storage | Store at -20°C |
| IUPAC Name | [4-[bis(1,3-benzodioxol-5-yl)methyl]piperidin-1-yl]-(1,2,4-triazol-1-yl)methanone |
| InChI | InChI=1S/C23H22N4O5/c28-23(27-12-24-11-25-27)26-7-5-15(6-8-26)22(16-1-3-18-20(9-16)31-13-29-18)17-2-4-19-21(10-17)32-14-30-19/h1-4,9-12,15,22H,5-8,13-14H2 |
| InChIKey | CLSNATLUIXZPMV-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(C2=CC3=C(C=C2)OCO3)C4=CC5=C(C=C4)OCO5)C(=O)N6C=NC=N6 |
| Reference | </br>1:Aaltonen N, Savinainen JR, Ribas CR, Rönkkö J, Kuusisto A, Korhonen J, Navia-Paldanius D, Häyrinen J, Takabe P, Käsnänen H, Pantsar T, Laitinen T, Lehtonen M, Pasonen-Seppänen S, Poso A, Nevalainen T, Laitinen JT. Piperazine and piperidine triazole ureas as ultrapotent and highly selective inhibitors of monoacylglycerol lipase. Chem Biol. 2013 Mar 21;20(3):379-90. doi: 10.1016/j.chembiol.2013.01.012. PubMed PMID: 23521796. |
