For research use only. Not for therapeutic Use.
JKE-1716 is a potent and selective nitrolic acid-containing GPX4 inhibitor. JKE-1716 is able of inducing ferroptosis selectively through covalent GPX4 inhibition[1].
JKE-1716 (0~100 nΜ; 72 hours; LOX-IMVI cells) inhibits cell viability[1].
JKE-1716 (LOX-IMVI cells) inhibits the expression of α-GPX4[1].
| Catalog Number | I044695 |
| CAS Number | 2421118-05-8 |
| Synonyms | (3Z)-1-[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]-3-hydroxyimino-3-nitropropan-1-one |
| Molecular Formula | C20H20Cl2N4O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C20H20Cl2N4O4/c21-16-5-1-14(2-6-16)20(15-3-7-17(22)8-4-15)25-11-9-24(10-12-25)19(27)13-18(23-28)26(29)30/h1-8,20,28H,9-13H2/b23-18- |
| InChIKey | HZFRTZXJNACSIE-NKFKGCMQSA-N |
| SMILES | C1CN(CCN1C(C2=CC=C(C=C2)Cl)C3=CC=C(C=C3)Cl)C(=O)CC(=NO)[N+](=O)[O-] |
| Reference | [1]. Eaton JK, et al. Selective covalent targeting of GPX4 using masked nitrile-oxide electrophiles. Nat Chem Biol. 2020;16(5):497-506. |
