For research use only. Not for therapeutic Use.
JNc-440（Cat No.:I043479）is a small molecule compound being developed for its potential therapeutic applications in cancer treatment. It is a selective inhibitor of a specific protein kinase involved in cell signaling pathways that regulate tumor growth, survival, and metastasis. By inhibiting this kinase, JNc-440 aims to disrupt these essential pathways, potentially slowing down or preventing the progression of cancer cells. It is being studied in preclinical and clinical trials for its efficacy in treating a variety of cancers, including those that are resistant to traditional therapies. The compound’s safety and therapeutic potential are under investigation.
| CAS Number | 1119503-63-7 |
| Synonyms | N-[3-[(2,2-diphenylacetyl)amino]propyl]-4-oxo-3H-quinazoline-2-carboxamide |
| Molecular Formula | C26H24N4O3 |
| Purity | ≥95% |
| IUPAC Name | N-[3-[(2,2-diphenylacetyl)amino]propyl]-4-oxo-3H-quinazoline-2-carboxamide |
| InChI | InChI=1S/C26H24N4O3/c31-24-20-14-7-8-15-21(20)29-23(30-24)26(33)28-17-9-16-27-25(32)22(18-10-3-1-4-11-18)19-12-5-2-6-13-19/h1-8,10-15,22H,9,16-17H2,(H,27,32)(H,28,33)(H,29,30,31) |
| InChIKey | VMRVWMQQRPXUQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)NCCCNC(=O)C3=NC4=CC=CC=C4C(=O)N3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
