For research use only, not for therapeutic use.
JNJ-40411813 (Cat No.:I000482) is a novel compound that acts as a positive allosteric modulator of the metabotropic glutamate 2 (mGlu2) receptor. The mGlu2 receptor is a G-protein-coupled receptor found in the central nervous system and is involved in the regulation of neurotransmission. By binding to a specific site on the mGlu2 receptor, JNJ-40411813 enhances the receptor’s activity, leading to increased modulation of glutamate signaling. This modulation has the potential to affect various neurological processes and may have therapeutic implications for conditions such as schizophrenia and other psychiatric disorders.
| Catalog Number | I000482 |
| CAS Number | 1127498-03-6 |
| Molecular Formula | C20H25ClN2O |
| Purity | ≥95% |
| Target | mGlu2R |
| Solubility | 10 mM in DMSO |
| Storage | 3 years -20C powder |
| IC50 | 147 nM(EC50) |
| IUPAC Name | 1-butyl-3-chloro-4-(4-phenylpiperidin-1-yl)pyridin-2-one |
| InChI | InChI=1S/C20H25ClN2O/c1-2-3-12-23-15-11-18(19(21)20(23)24)22-13-9-17(10-14-22)16-7-5-4-6-8-16/h4-8,11,15,17H,2-3,9-10,12-14H2,1H3 |
| InChIKey | HYOGJHCDLQSAHX-UHFFFAOYSA-N |
| SMILES | CCCCN1C=CC(=C(C1=O)Cl)N2CCC(CC2)C3=CC=CC=C3 |
| Reference | <br /> |
