For research use only. Not for therapeutic Use.
JNJ-42165279(Cat No.:I001329)is a selective small molecule inhibitor of the enzyme Bruton’s tyrosine kinase (BTK), which plays a critical role in B-cell receptor signaling. By inhibiting BTK, JNJ-42165279 aims to suppress B-cell activation and proliferation, making it a potential treatment for B-cell malignancies such as non-Hodgkin lymphoma and chronic lymphocytic leukemia (CLL). Additionally, it may have applications in autoimmune diseases where B-cells contribute to pathological immune responses. Preclinical studies and early-phase clinical trials are evaluating JNJ-42165279’s safety, efficacy, and its potential to improve treatment outcomes in these conditions.
CAS Number | 1346528-50-4 |
Synonyms | <em>N</em>-(4-chloro-3-pyridinyl)-4-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-1-piperazinecarboxamide |
Molecular Formula | C18H17ClF2N4O3 |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IC50 | 70 ± 8 nM (for hFAAH), 313 ± 28 nM (for rFAAH ) |
IUPAC Name | N-(4-chloropyridin-3-yl)-4-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]piperazine-1-carboxamide |
InChI | InChI=1S/C18H17ClF2N4O3/c19-13-3-4-22-10-14(13)23-17(26)25-7-5-24(6-8-25)11-12-1-2-15-16(9-12)28-18(20,21)27-15/h1-4,9-10H,5-8,11H2,(H,23,26) |
InChIKey | YWGYNGCRVZLMCS-UHFFFAOYSA-N |
SMILES | C1CN(CCN1CC2=CC3=C(C=C2)OC(O3)(F)F)C(=O)NC4=C(C=CN=C4)Cl |
Reference | <p style=/line-height:25px/> |