For research use only. Not for therapeutic Use.
JNJ-479655 (Cat.No:I007449) is a novel and potent selective antagonist of the prostaglandin EP4 receptor. It has been studied for its potential therapeutic applications in various inflammatory conditions, such as pain, inflammation, and autoimmune diseases. JNJ-479655 exhibits high affinity and selectivity for the EP4 receptor, making it a promising candidate for further preclinical and clinical investigations.
| Catalog Number | I007449 |
| CAS Number | 1428327-31-4 |
| Synonyms | JNJ-479655; JNJ 479655; JNJ479655.;N-[[4-(4-phenylpiperazin-1-yl)oxan-4-yl]methyl]-2-phenylsulfanylpyridine-3-carboxamide |
| Molecular Formula | C28H32N4O2S |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | N-[[4-(4-phenylpiperazin-1-yl)oxan-4-yl]methyl]-2-phenylsulfanylpyridine-3-carboxamide |
| InChI | InChI=1S/C28H32N4O2S/c33-26(25-12-7-15-29-27(25)35-24-10-5-2-6-11-24)30-22-28(13-20-34-21-14-28)32-18-16-31(17-19-32)23-8-3-1-4-9-23/h1-12,15H,13-14,16-22H2,(H,30,33) |
| InChIKey | XREFXUCWSYMIOG-UHFFFAOYSA-N |
| SMILES | C1COCCC1(CNC(=O)C2=C(N=CC=C2)SC3=CC=CC=C3)N4CCN(CC4)C5=CC=CC=C5 |
