For research use only. Not for therapeutic Use.
JNJ-54175446（Cat No.:I019654）, is a specific and potent inhibitor of phosphodiesterase 9A (PDE9A). It selectively binds to and inhibits the activity of PDE9A, an enzyme involved in the regulation of cyclic guanosine monophosphate (cGMP) levels in cells. By inhibiting PDE9A, JNJ-54175446 increases cGMP levels, which can have various physiological effects. This compound is primarily used as a research tool to study the role of PDE9A and explore its potential therapeutic applications in conditions related to cGMP signaling pathways.
| Catalog Number | I019654 |
| CAS Number | 1627902-21-9 |
| Molecular Formula | C₁₈H₁₃ClF₄N₆O |
| Purity | ≥95% |
| Target | P2X Receptor |
| IUPAC Name | [2-chloro-3-(trifluoromethyl)phenyl]-[(4R)-1-(5-fluoropyrimidin-2-yl)-4-methyl-6,7-dihydro-4H-triazolo[4,5-c]pyridin-5-yl]methanone |
| InChI | InChI=1S/C18H13ClF4N6O/c1-9-15-13(29(27-26-15)17-24-7-10(20)8-25-17)5-6-28(9)16(30)11-3-2-4-12(14(11)19)18(21,22)23/h2-4,7-9H,5-6H2,1H3/t9-/m1/s1 |
| InChIKey | CWFVVQFVGMFTBD-SECBINFHSA-N |
| SMILES | CC1C2=C(CCN1C(=O)C3=C(C(=CC=C3)C(F)(F)F)Cl)N(N=N2)C4=NC=C(C=N4)F |
| Reference | [1]. Letavic MA, et al. 4-Methyl-6,7-dihydro-4H-triazolo[4,5-c]pyridine-Based P2X7 Receptor Antagonists: Optimization of Pharmacokinetic Properties Leading to the Identification of a Clinical Candidate. Send to |
