For research use only. Not for therapeutic Use.
JNJ-9350(Cat No.:I042718)is a selective small molecule inhibitor designed to target and inhibit a specific enzyme involved in the regulation of immune responses. By modulating key signaling pathways, JNJ-9350 aims to reduce excessive inflammation and immune cell activation, making it a potential treatment for autoimmune diseases, inflammatory conditions, and certain cancers. In preclinical studies, it has shown promise in improving immune regulation and reducing disease symptoms. Ongoing research is focused on evaluating its safety, pharmacokinetics, and therapeutic potential in clinical trials for immune-mediated diseases and cancer therapies.
CAS Number | 326923-09-5 |
Synonyms | N-(3-imidazol-1-ylpropyl)-5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxamide |
Molecular Formula | C25H22N6O |
Purity | ≥95% |
IUPAC Name | N-(3-imidazol-1-ylpropyl)-5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxamide |
InChI | InChI=1S/C25H22N6O/c32-25(27-12-7-14-30-15-13-26-18-30)22-17-24-28-21(19-8-3-1-4-9-19)16-23(31(24)29-22)20-10-5-2-6-11-20/h1-6,8-11,13,15-18H,7,12,14H2,(H,27,32) |
InChIKey | RIGHCDSORZCRDE-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=CC(=NC3=CC(=NN23)C(=O)NCCCN4C=CN=C4)C5=CC=CC=C5 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |