For research use only. Not for therapeutic Use.
JQKD82 trihydrochloride(Cat No.:I043576)is a small molecule compound being investigated for its potential therapeutic applications in cancer treatment. It functions as a selective inhibitor of specific protein kinases involved in tumor cell growth and survival. By targeting these kinases, JQKD82 trihydrochloride aims to disrupt cancer cell proliferation, enhance apoptosis, and inhibit metastasis. This compound is being explored for its efficacy in treating various cancers, particularly those that are resistant to conventional therapies. Ongoing clinical trials are assessing its safety, pharmacokinetics, and potential as an effective cancer therapy.
CAS Number | 2863676-87-1 |
Synonyms | [2,4-di(propan-2-yloxy)phenyl] 2-[[[2-[2-(dimethylamino)ethyl-ethylamino]-2-oxoethyl]amino]methyl]pyridine-4-carboxylate;trihydrochloride |
Molecular Formula | C27H43Cl3N4O5 |
Purity | ≥95% |
IUPAC Name | [2,4-di(propan-2-yloxy)phenyl] 2-[[[2-[2-(dimethylamino)ethyl-ethylamino]-2-oxoethyl]amino]methyl]pyridine-4-carboxylate;trihydrochloride |
InChI | InChI=1S/C27H40N4O5.3ClH/c1-8-31(14-13-30(6)7)26(32)18-28-17-22-15-21(11-12-29-22)27(33)36-24-10-9-23(34-19(2)3)16-25(24)35-20(4)5;;;/h9-12,15-16,19-20,28H,8,13-14,17-18H2,1-7H3;3*1H |
InChIKey | VSTHCFWHQMJPDZ-UHFFFAOYSA-N |
SMILES | CCN(CCN(C)C)C(=O)CNCC1=NC=CC(=C1)C(=O)OC2=C(C=C(C=C2)OC(C)C)OC(C)C.Cl.Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |