For research use only. Not for therapeutic Use.
JR-220（Cat No.:I012541）is an investigational compound being developed as a potential treatment for malaria. It is a novel, synthetic antimalarial drug that targets the Plasmodium parasite responsible for malaria infection. JR-220 belongs to a class of compounds known as imidazolopiperazines and has shown promising preclinical activity against Plasmodium falciparum, the most deadly malaria parasite. The drug works by inhibiting key enzymes and disrupting parasite growth. JR-220 is being studied for its efficacy, safety, and ability to treat both drug-resistant and non-drug-resistant malaria strains. Clinical trials are ongoing to assess its potential in malaria treatment.
| Catalog Number | I012541 |
| CAS Number | 6933-71-7 |
| Synonyms | (4-Chlorobenzylidenamino)-guanidine hydrochloride ; JR220; NSC 65818 hydrochloride |
| Molecular Formula | C8H10Cl2N4 |
| Purity | ≥95% |
| IUPAC Name | 2-[(Z)-(4-chlorophenyl)methylideneamino]guanidine;hydrochloride |
| InChI | InChI=1S/C8H9ClN4.ClH/c9-7-3-1-6(2-4-7)5-12-13-8(10)11;/h1-5H,(H4,10,11,13);1H/b12-5-; |
| InChIKey | MYGZIWITMJYYMP-UHPXVVQNSA-N |
| SMILES | C1=CC(=CC=C1/C=N\N=C(N)N)Cl.Cl |
