For research use only. Not for therapeutic Use.
JTC-801（Cat No.:I002820）is a selective small molecule inhibitor of the protein tyrosine kinase MCL-1 (Myeloid cell leukemia sequence 1), an anti-apoptotic protein involved in regulating cell survival. MCL-1 is frequently overexpressed in various cancers, contributing to tumor cell survival, chemotherapy resistance, and metastasis. By inhibiting MCL-1, JTC-801 aims to promote cancer cell apoptosis and enhance the effectiveness of existing cancer therapies. Preclinical studies have shown its potential to induce cell death in cancer cells, particularly in hematological malignancies and solid tumors. JTC-801 is being explored for its therapeutic potential in combination with other anti-cancer agents.
| Catalog Number | I002820 |
| CAS Number | 244218-51-7 |
| Synonyms | N-(4-amino-2-methylquinolin-6-yl)-2-[(4-ethylphenoxy)methyl]benzamide;hydrochloride |
| Molecular Formula | C26H25N3O2 • HCl |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | DMSO ≥86mg/mL Water <1.2mg/mL Ethanol ≥36mg/mL |
| Storage | 3 years -20C powder |
| IC50 | 94 nM |
| IUPAC Name | N-(4-amino-2-methylquinolin-6-yl)-2-[(4-ethylphenoxy)methyl]benzamide;hydrochloride |
| InChI | InChI=1S/C26H25N3O2.ClH/c1-3-18-8-11-21(12-9-18)31-16-19-6-4-5-7-22(19)26(30)29-20-10-13-25-23(15-20)24(27)14-17(2)28-25;/h4-15H,3,16H2,1-2H3,(H2,27,28)(H,29,30);1H |
| InChIKey | NQLIYKXNAXKMBL-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)OCC2=CC=CC=C2C(=O)NC3=CC4=C(C=C(N=C4C=C3)C)N.Cl |
| Reference | <p style=/line-height:25px/> |
