For research use only. Not for therapeutic Use.
Juvenile Hormone II is a crucial insect hormone that regulates development, reproduction, and metamorphosis in insects. It maintains larval characteristics during early developmental stages and inhibits the transition to the pupal and adult phases. This hormone plays a significant role in controlling molting and reproductive maturation. Juvenile Hormone II is extensively studied in entomology and insect control research, as its analogs can be used in pest management strategies to disrupt insect growth and development, reducing populations in agricultural settings.
CAS Number | 34218-61-6 |
Synonyms | [2R-[2α(2E,6E),3α]]-9-(3-Ethyl-3-methyloxiranyl)-3,7-dimethyl-2,6-nonadienoic acid methyl ester; ?(E,E)-(10R,11S)-(+)-10,11-Epoxy-3,7,11-trimethyl-2,6-tridecadienoic acid methyl ester; (10R,11S)-(+)-Juvenile hormone II; (10R,11S)-Juvenile hormone II; |
Molecular Formula | C17H28O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl (2E,6E)-9-[(2R,3S)-3-ethyl-3-methyloxiran-2-yl]-3,7-dimethylnona-2,6-dienoate |
InChI | InChI=1S/C17H28O3/c1-6-17(4)15(20-17)11-10-13(2)8-7-9-14(3)12-16(18)19-5/h8,12,15H,6-7,9-11H2,1-5H3/b13-8+,14-12+/t15-,17+/m1/s1 |
InChIKey | CPVQJXZBSGXTGJ-TZDLBHCHSA-N |
SMILES | CCC1(C(O1)CCC(=CCCC(=CC(=O)OC)C)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |