For research use only. Not for therapeutic Use.
JWH 166-d3 is a high-purity deuterated compound essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of JWH 166, containing three deuterium atoms, is crucial for studies involving cannabinoid receptor interactions, drug metabolism, and pharmacokinetics. Its stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. JWH 166-d3 is particularly useful in the investigation of synthetic cannabinoids and the development of new therapeutic agents targeting the endocannabinoid system. With improved stability and consistency, it integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
CAS Number | NA |
Synonyms | (6-Methoxy-1-naphthalenyl)(1-pentyl-1H-indol-3-yl)-methanone-d3 |
Molecular Formula | C₂₅H₂₂D₃NO₂ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (1-pentylindol-3-yl)-[6-(trideuteriomethoxy)naphthalen-1-yl]methanone |
InChI | InChI=1S/C25H25NO2/c1-3-4-7-15-26-17-23(21-10-5-6-12-24(21)26)25(27)22-11-8-9-18-16-19(28-2)13-14-20(18)22/h5-6,8-14,16-17H,3-4,7,15H2,1-2H3/i2D3 |
InChIKey | JCOOBICVPDFZNX-BMSJAHLVSA-N |
SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=C1)C(=CC=C2)C(=O)C3=CN(C4=CC=CC=C43)CCCCC |