For research use only. Not for therapeutic Use.
JWH 193 is a synthetic cannabinoid (CB) which binds the central CB<sub>1</sub> receptor with high affinity (K<sub>i</sub> = 6 nM). This aminoalkylindole shares structural features with the antinociceptive CB<sub>1</sub> agonists pravadoline (Item No. <span class=/itemid/>10006973</span>) and WIN 55,212-<wbr></wbr>2. The physiological and toxicological properties of this compound have not been investigated. This product is intended for research and forensic applications.
| Catalog Number | R064582 |
| CAS Number | 133438-58-1 |
| Synonyms | (4-methyl-1-naphthalenyl)[1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl]-methanone |
| Molecular Formula | C26H26N2O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (4-methylnaphthalen-1-yl)-[1-(2-morpholin-4-ylethyl)indol-3-yl]methanone |
| InChI | InChI=1S/C26H26N2O2/c1-19-10-11-23(21-7-3-2-6-20(19)21)26(29)24-18-28(25-9-5-4-8-22(24)25)13-12-27-14-16-30-17-15-27/h2-11,18H,12-17H2,1H3 |
| InChIKey | ICKWPPYMDARCKJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C2=CC=CC=C12)C(=O)C3=CN(C4=CC=CC=C43)CCN5CCOCC5 |
| Reference | 1.Huffman, J.W., and Padgett, L.W. Recent developments in the medicinal chemistry of cannabimimetic indoles, pyrroles and indenes. Current Medicinal Chemistry 12, 1395-1411 (2005). |
