For research use only. Not for therapeutic Use.
JWH015 is a selective CB2 agonist (Ki values are 13.8 and 383 nM as measured at human cloned CB2 and CB1 receptors expressed in CHO cells).
| Catalog Number | I007466 |
| CAS Number | 155471-08-2 |
| Synonyms | JWH015; JWH 015; JWH-015.;(2-methyl-1-propylindol-3-yl)-naphthalen-1-ylmethanone |
| Molecular Formula | C23H21NO |
| Purity | ≥95% |
| Target | CB2 agonist |
| Solubility | Soluble in DMSO |
| Storage | -20°C |
| IUPAC Name | (2-methyl-1-propylindol-3-yl)-naphthalen-1-ylmethanone |
| InChI | InChI=1S/C23H21NO/c1-3-15-24-16(2)22(20-12-6-7-14-21(20)24)23(25)19-13-8-10-17-9-4-5-11-18(17)19/h4-14H,3,15H2,1-2H3 |
| InChIKey | LJSBBBWQTLXQEN-UHFFFAOYSA-N |
| SMILES | CCCN1C(=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=CC=CC=C43)C |
