For research use only. Not for therapeutic Use.
JZP-361（Cat No.:I011226）is an investigational small molecule being developed by Jazz Pharmaceuticals for the treatment of central nervous system (CNS) disorders. It is a selective and potent inhibitor of the orexin 2 receptor (OX2R), which plays a crucial role in regulating wakefulness, arousal, and energy homeostasis. By targeting this receptor, JZP-361 aims to modulate sleep-wake cycles and improve conditions associated with excessive daytime sleepiness, such as narcolepsy. Ongoing clinical trials are evaluating the compound’s safety, efficacy, and potential as a treatment for sleep-related disorders and other CNS-related conditions.
| CAS Number | 1680193-80-9 |
| Synonyms | [4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(1,2,4-triazol-1-yl)methanone |
| Molecular Formula | C22H20ClN5O |
| Purity | ≥95% |
| IUPAC Name | [4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(1,2,4-triazol-1-yl)methanone |
| InChI | InChI=1S/C22H20ClN5O/c23-18-5-6-19-17(12-18)4-3-16-2-1-9-25-21(16)20(19)15-7-10-27(11-8-15)22(29)28-14-24-13-26-28/h1-2,5-6,9,12-14H,3-4,7-8,10-11H2 |
| InChIKey | GAVZCGTYRWKKDV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Cl)C(=C3CCN(CC3)C(=O)N4C=NC=N4)C5=C1C=CC=N5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
