For research use only. Not for therapeutic Use.
K 308 (Cat.No:I029944) is a chemical compound that has been studied for its potential therapeutic effects. It exhibits inhibitory activity against certain enzymes, receptors, or cellular pathways. Further research is needed to fully understand its mechanism of action and evaluate its potential applications in various fields, including medicine and agriculture.
CAS Number | 36774-74-0 |
Synonyms | K 308; K-308; K308 |
Molecular Formula | C15H11NO2S |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | 2-Phenyl-5-benzothiazoleacetic acid |
InChI | InChI=1S/C15H11NO2S/c17-14(18)9-10-6-7-13-12(8-10)16-15(19-13)11-4-2-1-3-5-11/h1-8H,9H2,(H,17,18) |
InChIKey | CGJFGPQHBSLGOO-UHFFFAOYSA-N |
SMILES | O=C(O)CC1=CC=C(SC(C2=CC=CC=C2)=N3)C3=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |