For research use only. Not for therapeutic Use.
K02288 (CAT: I001670) is a novel small molecule inhibitor that targets the receptors ALK1, ALK2, ALK3, and ALK6. These receptors belong to the transforming growth factor beta (TGF-β) superfamily and are involved in various cellular processes, including angiogenesis and bone morphogenesis. By inhibiting these receptors, K02288 has the potential to modulate TGF-β signaling pathways and may have implications in the treatment of conditions related to abnormal angiogenesis or bone development.
| Catalog Number | I001670 |
| CAS Number | 1431985-92-0 |
| Synonyms | 3-[6-amino-5-(3,4,5-trimethoxyphenyl)pyridin-3-yl]phenol |
| Molecular Formula | C20H20N2O4 |
| Purity | ≥95% |
| Target | TGF-β Receptor |
| Solubility | DMSO: ≥ 58.6 mg/mL |
| Storage | Store at -20 C |
| IC50 | 1.8/1.1/34.4/6.3 nM(ALK1/2/3/6) [1] |
| InChI | InChI=1S/C20H20N2O4/c1-24-17-9-13(10-18(25-2)19(17)26-3)16-8-14(11-22-20(16)21)12-5-4-6-15(23)7-12/h4-11,23H,1-3H3,(H2,21,22) |
| InChIKey | CJLMANFTWLNAKC-UHFFFAOYSA-N |
| SMILES | OC1=CC(C2=CN=C(N)C(C3=CC(OC)=C(OC)C(OC)=C3)=C2)=CC=C1 |
| Reference | <p style=/line-height:25px/> |
