For research use only. Not for therapeutic Use.
K252c(Cat No.:R021029)is a potent, selective inhibitor of protein kinase activity, primarily targeting receptor tyrosine kinases and cyclin-dependent kinases. Its structural similarity to the natural product staurosporine allows it to effectively modulate various signaling pathways involved in cell proliferation and differentiation. K252c has demonstrated potential in cancer research, particularly in inhibiting tumor growth and inducing apoptosis in various cancer cell lines. Additionally, its role in neurobiology has been explored, showcasing effects on neuronal survival and differentiation. This compound is a valuable tool for understanding kinase-related mechanisms in both cancer and neurodegenerative diseases.
CAS Number | 85753-43-1 |
Synonyms | 6,7,12,13-Tetrahydro-5H-Indolo[2,3-a]pyrrolo[3,4-c]carbazol-5-one; Antibiotic K 252c; SD 1825; Staurosporine Aglycon; Staurosporinone |
Molecular Formula | C20H13N3O |
Purity | ≥95% |
Target | TGF-beta/Smad |
Solubility | >15.6mg/mL in DMSO |
Storage | Store at -20°C |
IUPAC Name | 3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-12-one |
InChI | InChI=1S/C20H13N3O/c24-20-17-12(9-21-20)15-10-5-1-3-7-13(10)22-18(15)19-16(17)11-6-2-4-8-14(11)23-19/h1-8,22-23H,9H2,(H,21,24) |
InChIKey | MEXUTNIFSHFQRG-UHFFFAOYSA-N |
SMILES | C1C2=C3C4=CC=CC=C4NC3=C5C(=C2C(=O)N1)C6=CC=CC=C6N5 |