For research use only. Not for therapeutic Use.
K6PC-5(Cat No.:I011936) is a compound that acts as an activator of sphingosine kinase 1 (SphK1). Sphingosine kinases are enzymes involved in the metabolism of sphingolipids, specifically converting sphingosine into sphingosine-1-phosphate (S1P). By activating SphK1, K6PC-5 enhances the production of S1P, a bioactive lipid with diverse cellular functions. S1P plays a crucial role in various physiological processes, including cell proliferation, migration, and survival. The activation of SphK1 by K6PC-5 represents a potential therapeutic strategy for modulating S1P signaling pathways and exploring its implications in different disease conditions.
CAS Number | 756875-51-1 |
Synonyms | K6PC-5; K6PC 5; K6PC5;2-Hexyl-N-[2-hydroxy-1-(hydroxymethyl)ethyl]-3-oxo-decanamide |
Molecular Formula | C19H37NO4 |
Purity | ≥95% |
Target | Anti-infection |
Solubility | Soluble in DMSO |
Storage | -20°C |
IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-2-hexyl-3-oxodecanamide |
InChI | InChI=1S/C19H37NO4/c1-3-5-7-9-11-13-18(23)17(12-10-8-6-4-2)19(24)20-16(14-21)15-22/h16-17,21-22H,3-15H2,1-2H3,(H,20,24) |
InChIKey | CGYVFCHCRBGGJG-UHFFFAOYSA-N |
SMILES | CCCCCCCC(=O)C(CCCCCC)C(=O)NC(CO)CO |