For research use only. Not for therapeutic Use.
Kadsurenone（Cat No.:R030212）is a natural organic compound classified as a sesquiterpene. It is primarily found in various plants, especially within the genus Kadsura, and has garnered interest due to its bioactive properties. Studies have suggested that Kadsurenone may exhibit antimicrobial, anti-inflammatory, and anticancer activities. Its potential therapeutic uses are being explored in pharmacological research, particularly for treating diseases related to inflammation and infections. Additionally, Kadsurenone’s unique chemical structure contributes to its ability to interact with cellular targets, making it a subject of interest in drug development.
| Catalog Number | R030212 |
| CAS Number | 95851-37-9 |
| Synonyms | (2S,3R,3aS)-2-(3,4-dimethoxyphenyl)-3a-methoxy-3-methyl-5-prop-2-enyl-2,3-dihydro-1-benzofuran-6-one |
| Molecular Formula | C21H24O5 |
| Purity | ≥95% |
| IUPAC Name | (2S,3R,3aS)-2-(3,4-dimethoxyphenyl)-3a-methoxy-3-methyl-5-prop-2-enyl-2,3-dihydro-1-benzofuran-6-one |
| InChI | InChI=1S/C21H24O5/c1-6-7-15-12-21(25-5)13(2)20(26-19(21)11-16(15)22)14-8-9-17(23-3)18(10-14)24-4/h6,8-13,20H,1,7H2,2-5H3/t13-,20+,21+/m1/s1 |
| InChIKey | VDYACOATPFOZIO-UBWHGVKJSA-N |
| SMILES | C[C@@H]1[C@H](OC2=CC(=O)C(=C[C@]12OC)CC=C)C3=CC(=C(C=C3)OC)OC |
