For research use only. Not for therapeutic Use.
Kaempferol-3-O-rutinoside(Cat No.:M084355), also known as nicotiflorin, is a naturally occurring flavonol glycoside derived from kaempferol, a well-known antioxidant flavonoid. This compound is found in various plants and foods, including kale, tea, and broccoli. It consists of kaempferol linked to the disaccharide rutinose, enhancing its water solubility compared to its aglycone form, kaempferol. Kaempferol-3-O-rutinoside is studied for its potential health benefits, including anti-inflammatory, cardioprotective, and neuroprotective effects.
Catalog Number | M084355 |
CAS Number | 17650-84-9 |
Molecular Formula | C27H30O15 |
Purity | ≥95% |
Target | Plants |
Storage | Desiccate at RT |
IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
InChI | InChI=1S/C27H30O15/c1-9-17(31)20(34)22(36)26(39-9)38-8-15-18(32)21(35)23(37)27(41-15)42-25-19(33)16-13(30)6-12(29)7-14(16)40-24(25)10-2-4-11(28)5-3-10/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15+,17-,18+,20+,21-,22+,23+,26+,27-/m0/s1 |
InChIKey | RTATXGUCZHCSNG-QHWHWDPRSA-N |
SMILES | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC=C(C=C5)O)O)O)O)O)O)O |