For research use only. Not for therapeutic Use.
Kaempferol（Cat No.:I003885）is a natural flavonoid found in various fruits and vegetables, essential for advanced biochemical and pharmacological research. Known for its potent antioxidant, anti-inflammatory, and anticancer properties, it plays a crucial role in studying cellular processes and disease prevention. This high-purity compound ensures precise and reliable analytical results, making it ideal for experimental setups focused on natural product research and drug development. Kaempferol supports robust investigations into novel therapeutic applications, offering significant potential in oncology, cardiovascular health, and neuroprotection, and enhancing the understanding of its beneficial effects on human health.
| Catalog Number | I003885 |
| CAS Number | 520-18-3 |
| Synonyms | 3,5,7-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| Molecular Formula | C15H10O6 |
| Purity | ≥95% |
| Target | Others |
| Solubility | DMSO: ≥ 32 mg/mL |
| Storage | 3 years -20C powder |
| IC50 | Kaempferol inhibits proliferation of ovarian cancer cells at 40μM or higher concentrations[2]. |
| IUPAC Name | 3,5,7-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| InChI | InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,16-18,20H |
| InChIKey | IYRMWMYZSQPJKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
