For research use only. Not for therapeutic Use.
Kahweol(Cat No.:R040524)is a bioactive compound found in coffee, particularly in the beans of Coffea canephora (robusta coffee). Known for its antioxidant and anti-inflammatory properties, kahweol has garnered interest for its potential health benefits, including protective effects against certain cancers and liver diseases. Research suggests that kahweol may enhance the immune response and promote apoptosis in cancer cells, contributing to its anticancer properties. Additionally, its role in modulating metabolic processes underscores its potential as a therapeutic agent. Kahweol’s diverse effects make it a significant compound for further study in health and disease management.
CAS Number | 6894-43-5 |
Synonyms | (3bS,5aS,7R,8R,10aR,10bS)-3b,4,5,6,7,8,9,10,10a,10b-Decahydro-7-hydroxy-10b-methyl-5a,8-methano-5aH-cyclohepta[5,6]naphtho[2,1-b]furan-7-methanol; |
Molecular Formula | C20H26O3 |
Purity | ≥95% |
Target | PI3K/Akt/mTOR |
Storage | -20°C |
IUPAC Name | (1S,4S,12S,13R,16R,17R)-17-(hydroxymethyl)-12-methyl-8-oxapentacyclo[14.2.1.01,13.04,12.05,9]nonadeca-5(9),6,10-trien-17-ol |
InChI | InChI=1S/C20H26O3/c1-18-7-5-16-14(6-9-23-16)15(18)4-8-19-10-13(2-3-17(18)19)20(22,11-19)12-21/h5-7,9,13,15,17,21-22H,2-4,8,10-12H2,1H3/t13-,15-,17+,18-,19+,20+/m1/s1 |
InChIKey | JEKMKNDURXDJAD-HWUKTEKMSA-N |
SMILES | C[C@@]12C=CC3=C([C@H]1CC[C@]45[C@H]2CC[C@H](C4)[C@](C5)(CO)O)C=CO3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |