For research use only. Not for therapeutic Use.
Kaji-ichigoside F1 is a glycoside derived from the Japanese strawberry, known for its potential health benefits. This compound exhibits antioxidant properties and may contribute to anti-inflammatory effects, making it of interest in nutraceutical and functional food research. Its unique structure, featuring a sugar moiety linked to an active aglycone, enhances its bioavailability and biological activity. Studies suggest that Kaji-ichigoside F1 may play a role in protecting against oxidative stress and supporting overall health, highlighting its potential as a natural therapeutic agent.
Catalog Number | R066395 |
CAS Number | 95298-47-8 |
Molecular Formula | C36H58O10 |
Purity | ≥95% |
Target | Antibiotic |
Storage | -20°C |
IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1R,2R,4aS,6aR,6aS,6bR,8aR,10S,11R,12aR,14bS)-1,10,11-trihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
InChI | InChI=1S/C36H58O10/c1-18-10-13-36(30(43)46-29-26(41)25(40)24(39)21(17-37)45-29)15-14-33(5)19(27(36)35(18,7)44)8-9-23-32(4)16-20(38)28(42)31(2,3)22(32)11-12-34(23,33)6/h8,18,20-29,37-42,44H,9-17H2,1-7H3/t18-,20-,21-,22+,23-,24-,25+,26-,27-,28-,29+,32+,33-,34-,35-,36+/m1/s1 |
InChIKey | MLKQAGPAYHTNQQ-FUZXVMJXSA-N |
SMILES | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(C)C)O)O)C)C)C2C1(C)O)C)C(=O)OC6C(C(C(C(O6)CO)O)O)O |