For research use only. Not for therapeutic Use.
Karanjin(Cat No.:M004968)is a flavonoid compound derived from the seeds of the Pongamia pinnata tree, known for its diverse biological activities. It exhibits significant antioxidant, anti-inflammatory, and antimicrobial properties, making it a candidate for various therapeutic applications. Research indicates that karanjin can inhibit tumor growth and enhance liver function, contributing to its potential in cancer and liver disease treatment. Additionally, it has shown promise in promoting skin health and wound healing. Its multifunctional nature highlights its importance in natural product research and the development of phytopharmaceuticals.
CAS Number | 521-88-0 |
Synonyms | 3-METHOXY-2-PHENYL-4H-FURO[2,3-H]-1-BENZOPYRAN-4-ONE;KARANJIN;karanjin from pongamia glabra oil;2-Phenyl-3-methoxy-4H-furo[2,3-h]-1-benzopyran-4-one;Kranjin;3-methoxy-2-phenyl-furo[2,3-h]chromen-4-one;3-methoxy-2-phenylfuro[2,3-h]chromen-4-one;NSC 33 |
Molecular Formula | C18H12O4 |
Purity | ≥95% |
Target | PI3K/Akt/mTOR |
Storage | -20°C |
IUPAC Name | 3-methoxy-2-phenylfuro[2,3-h]chromen-4-one |
InChI | InChI=1S/C18H12O4/c1-20-18-15(19)13-7-8-14-12(9-10-21-14)17(13)22-16(18)11-5-3-2-4-6-11/h2-10H,1H3 |
InChIKey | LKPQNZRGGNOPPU-UHFFFAOYSA-N |
SMILES | COC1=C(OC2=C(C1=O)C=CC3=C2C=CO3)C4=CC=CC=C4 |
Reference | 1: Michaelis M, Rothweiler F, Nerreter T, Sharifi M, Ghafourian T, Cinatl J. <br> 3: Jaiswal N, Yadav PP, Maurya R, Srivastava AK, Tamrakar AK. Karanjin from 4: Bose M, Chakraborty M, Bhattacharya S, Mukherjee D, Mandal S, Mishra R. 5: Vismaya, Belagihally SM, Rajashekhar S, Jayaram VB, Dharmesh SM, Thirumakudalu <br> 7: Katekhaye S, Kale MS, Laddha KS. Development and Validation of an HPLC Method |