For research use only. Not for therapeutic Use.
Kazinol A induces cytotoxic effects in human bladder cancer cells, including the cisplatin-resistant T24R2[1].
| Catalog Number | I045589 |
| CAS Number | 99624-28-9 |
| Synonyms | 4-[(2S)-7-hydroxy-3,4-dihydro-2H-chromen-2-yl]-3,6-bis(3-methylbut-2-enyl)benzene-1,2-diol |
| Molecular Formula | C25H30O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C25H30O4/c1-15(2)5-7-18-13-21(20(11-6-16(3)4)25(28)24(18)27)22-12-9-17-8-10-19(26)14-23(17)29-22/h5-6,8,10,13-14,22,26-28H,7,9,11-12H2,1-4H3/t22-/m0/s1 |
| InChIKey | QXHVECWDOBLWPW-QFIPXVFZSA-N |
| SMILES | CC(=CCC1=CC(=C(C(=C1O)O)CC=C(C)C)C2CCC3=C(O2)C=C(C=C3)O)C |
| Reference | [1]. Park S, et al. Cytotoxic effects of kazinol A derived from Broussonetia papyrifera on human bladder cancer cells, T24 and T24R2. Phytomedicine. 2016;23(12):1462-1468. |
