For research use only. Not for therapeutic Use.
KB02-COOH is a fragment of synthesis of ubiquitin E3 ligase ligand KB02. KB02 can be used in the synthesis of PROTAC, such as KB02-JQ1 (HY-129917) and KB02-SLF (HY-129610)[1].
| Catalog Number | I045462 |
| CAS Number | 2375196-30-6 |
| Synonyms | 2-[[1-(2-chloroacetyl)-3,4-dihydro-2H-quinolin-6-yl]oxy]acetic acid |
| Molecular Formula | C13H14ClNO4 |
| Purity | ≥95% |
| InChI | InChI=1S/C13H14ClNO4/c14-7-12(16)15-5-1-2-9-6-10(3-4-11(9)15)19-8-13(17)18/h3-4,6H,1-2,5,7-8H2,(H,17,18) |
| InChIKey | ZWIYQLVGARZWJJ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)OCC(=O)O)N(C1)C(=O)CCl |
| Reference | [1]. Zhang X, et al. Electrophilic PROTACs that degrade nuclear proteins by engaging DCAF16. Nat Chem Biol. 2019 Jul;15(7):737-746. |
